C13H16N6O2 — CID 136586362
(2-methoxypyrimidin-4-yl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 136586362) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is (2-methoxypyrimidin-4-yl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-methoxypyrimidin-4-yl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 136586362 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (2-methoxypyrimidin-4-yl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1nccc(C(=O)N2CCC[C@H]2Cn2ccnn2)n1 |
| InChI | InChI=1S/C13H16N6O2/c1-21-13-14-5-4-11(16-13)12(20)19-7-2-3-10(19)9-18-8-6-15-17-18/h4-6,8,10H,2-3,7,9H2,1H3/t10-/m0/s1 |
| InChIKey | SDEVPHFNRVHBNW-JTQLQIEISA-N |
| XLogP | 0.38 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |