C14H15F3N6O — CID 99856614
[(2S)-2-(triazol-1-ylmethyl)piperidin-1-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone (PubChem CID 99856614) has the molecular formula C14H15F3N6O and a molecular weight of 340.31 g/mol. Its IUPAC name is [(2S)-2-(triazol-1-ylmethyl)piperidin-1-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone.
| Compound Name | [(2S)-2-(triazol-1-ylmethyl)piperidin-1-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 99856614 |
| Molecular Formula | C14H15F3N6O |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [(2S)-2-(triazol-1-ylmethyl)piperidin-1-yl]-[2-(trifluoromethyl)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(C(F)(F)F)nc1)N1CCCC[C@H]1Cn1ccnn1 |
| InChI | InChI=1S/C14H15F3N6O/c15-14(16,17)13-18-7-10(8-19-13)12(24)23-5-2-1-3-11(23)9-22-6-4-20-21-22/h4,6-8,11H,1-3,5,9H2/t11-/m0/s1 |
| InChIKey | ARPUBOZAEFUPIW-NSHDSACASA-N |
| XLogP | 1.78 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |