C14H14ClFN4O2 — CID 136585167
(3R,4S)-1-[5-chloro-4-(4-fluoroanilino)pyrimidin-2-yl]pyrrolidine-3,4-diol (PubChem CID 136585167) has the molecular formula C14H14ClFN4O2 and a molecular weight of 324.74 g/mol. Its IUPAC name is (3R,4S)-1-[5-chloro-4-(4-fluoroanilino)pyrimidin-2-yl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[5-chloro-4-(4-fluoroanilino)pyrimidin-2-yl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 136585167 |
| Molecular Formula | C14H14ClFN4O2 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (3R,4S)-1-[5-chloro-4-(4-fluoroanilino)pyrimidin-2-yl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(c2ncc(Cl)c(Nc3ccc(F)cc3)n2)C[C@@H]1O |
| InChI | InChI=1S/C14H14ClFN4O2/c15-10-5-17-14(20-6-11(21)12(22)7-20)19-13(10)18-9-3-1-8(16)2-4-9/h1-5,11-12,21-22H,6-7H2,(H,17,18,19)/t11-,12+ |
| InChIKey | JGWOHRCDSGLYSQ-TXEJJXNPSA-N |
| XLogP | 1.55 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |