C20H27N3O2 — CID 136587064
2-(3,5-diethyl-1-methylpyrazol-4-yl)-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 136587064) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-(3,5-diethyl-1-methylpyrazol-4-yl)-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-(3,5-diethyl-1-methylpyrazol-4-yl)-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 136587064 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-(3,5-diethyl-1-methylpyrazol-4-yl)-N-[(1S,2R)-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | CCc1nn(C)c(CC)c1CC(=O)N[C@H]1c2ccccc2CC[C@H]1O |
| InChI | InChI=1S/C20H27N3O2/c1-4-16-15(17(5-2)23(3)22-16)12-19(25)21-20-14-9-7-6-8-13(14)10-11-18(20)24/h6-9,18,20,24H,4-5,10-12H2,1-3H3,(H,21,25)/t18-,20+/m1/s1 |
| InChIKey | IUXSSQMYNLZJSI-QUCCMNQESA-N |
| XLogP | 2.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |