C17H21N3O4 — CID 136587613
N-[(3R,4R)-4-methoxyoxan-3-yl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 136587613) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[(3R,4R)-4-methoxyoxan-3-yl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3R,4R)-4-methoxyoxan-3-yl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 136587613 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[(3R,4R)-4-methoxyoxan-3-yl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)N[C@@H]3COCC[C@H]3OC)[nH]n2)c1 |
| InChI | InChI=1S/C17H21N3O4/c1-22-12-5-3-4-11(8-12)13-9-14(20-19-13)17(21)18-15-10-24-7-6-16(15)23-2/h3-5,8-9,15-16H,6-7,10H2,1-2H3,(H,18,21)(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | PBNXUTLZUUSAOA-HZPDHXFCSA-N |
| XLogP | 1.62 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |