C21H22N4O3 — CID 91779690
3-phenyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-pyrazole-5-carboxamide (PubChem CID 91779690) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-phenyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 91779690 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-phenyl-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCc1ccccn1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C21H22N4O3/c26-21(19-12-18(24-25-19)15-6-2-1-3-7-15)23-17-9-11-27-14-20(17)28-13-16-8-4-5-10-22-16/h1-8,10,12,17,20H,9,11,13-14H2,(H,23,26)(H,24,25)/t17-,20-/m1/s1 |
| InChIKey | CJPJBPQMHYLUJI-YLJYHZDGSA-N |
| XLogP | 2.58 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |