C17H20N2O3S — CID 91759680
N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2-thiophen-3-ylacetamide (PubChem CID 91759680) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 91759680 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)N[C@@H]1CCOC[C@H]1OCc1ccccn1 |
| InChI | InChI=1S/C17H20N2O3S/c20-17(9-13-5-8-23-12-13)19-15-4-7-21-11-16(15)22-10-14-3-1-2-6-18-14/h1-3,5-6,8,12,15-16H,4,7,9-11H2,(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | OQUUYUKLWKTHPA-HZPDHXFCSA-N |
| XLogP | 2.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |