C20H22N2O5 — CID 156609865
2-(1,3-benzodioxol-5-yl)-N-[3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide (PubChem CID 156609865) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 156609865 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)NC1CCOCC1OCc1ccccn1 |
| InChI | InChI=1S/C20H22N2O5/c23-20(10-14-4-5-17-18(9-14)27-13-26-17)22-16-6-8-24-12-19(16)25-11-15-3-1-2-7-21-15/h1-5,7,9,16,19H,6,8,10-13H2,(H,22,23) |
| InChIKey | MCOMUZRXCCHXLT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |