C19H20N4O3 — CID 91764518
N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-indazole-3-carboxamide (PubChem CID 91764518) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 91764518 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-1H-indazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCc1ccccn1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C19H20N4O3/c24-19(18-14-6-1-2-7-15(14)22-23-18)21-16-8-10-25-12-17(16)26-11-13-5-3-4-9-20-13/h1-7,9,16-17H,8,10-12H2,(H,21,24)(H,22,23)/t16-,17-/m1/s1 |
| InChIKey | HCAZNTHIGQMVEE-IAGOWNOFSA-N |
| XLogP | 2.06 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |