C18H19N5O3 — CID 91772579
N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2H-benzotriazole-5-carboxamide (PubChem CID 91772579) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 91772579 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1OCc1ccccn1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C18H19N5O3/c24-18(12-4-5-14-16(9-12)22-23-21-14)20-15-6-8-25-11-17(15)26-10-13-3-1-2-7-19-13/h1-5,7,9,15,17H,6,8,10-11H2,(H,20,24)(H,21,22,23)/t15-,17-/m1/s1 |
| InChIKey | IDINNDJGHOZJAE-NVXWUHKLSA-N |
| XLogP | 1.46 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |