C15H21N3O4 — CID 91767025
2-acetamido-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide (PubChem CID 91767025) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-acetamido-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide.
| Compound Name | 2-acetamido-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 91767025 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-acetamido-N-[(3S,4R)-3-(pyridin-2-ylmethoxy)oxan-4-yl]acetamide |
| SMILES | CC(=O)NCC(=O)N[C@@H]1CCOC[C@H]1OCc1ccccn1 |
| InChI | InChI=1S/C15H21N3O4/c1-11(19)17-8-15(20)18-13-5-7-21-10-14(13)22-9-12-4-2-3-6-16-12/h2-4,6,13-14H,5,7-10H2,1H3,(H,17,19)(H,18,20)/t13-,14-/m1/s1 |
| InChIKey | KQZQGDGPQQMCBU-ZIAGYGMSSA-N |
| XLogP | 0.01 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |