C18H21NO4S — CID 136587791
1-[(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-(5,6-dimethyl-1-benzofuran-3-yl)ethanone (PubChem CID 136587791) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-(5,6-dimethyl-1-benzofuran-3-yl)ethanone.
| Compound Name | 1-[(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-(5,6-dimethyl-1-benzofuran-3-yl)ethanone |
|---|---|
| PubChem CID | 136587791 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-[(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-(5,6-dimethyl-1-benzofuran-3-yl)ethanone |
| SMILES | Cc1cc2occ(CC(=O)N3C[C@@H]4CCS(=O)(=O)[C@@H]4C3)c2cc1C |
| InChI | InChI=1S/C18H21NO4S/c1-11-5-15-14(10-23-16(15)6-12(11)2)7-18(20)19-8-13-3-4-24(21,22)17(13)9-19/h5-6,10,13,17H,3-4,7-9H2,1-2H3/t13-,17+/m0/s1 |
| InChIKey | MCHHTZAHYVSTGS-SUMWQHHRSA-N |
| XLogP | 2.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |