C8H13NO3S — CID 126758745
1-(1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl)ethanone (PubChem CID 126758745) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is 1-(1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl)ethanone.
| Compound Name | 1-(1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl)ethanone |
|---|---|
| PubChem CID | 126758745 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 1-(1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl)ethanone |
| SMILES | CC(=O)N1CC2CCS(=O)(=O)C2C1 |
| InChI | InChI=1S/C8H13NO3S/c1-6(10)9-4-7-2-3-13(11,12)8(7)5-9/h7-8H,2-5H2,1H3 |
| InChIKey | KKPMGVAMZJJCTL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |