C19H19FN2O3S — CID 126798892
[(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[2-(4-fluoroanilino)phenyl]methanone (PubChem CID 126798892) has the molecular formula C19H19FN2O3S and a molecular weight of 374.44 g/mol. Its IUPAC name is [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[2-(4-fluoroanilino)phenyl]methanone.
| Compound Name | [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[2-(4-fluoroanilino)phenyl]methanone |
|---|---|
| PubChem CID | 126798892 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-[2-(4-fluoroanilino)phenyl]methanone |
| SMILES | O=C(c1ccccc1Nc1ccc(F)cc1)N1C[C@@H]2CCS(=O)(=O)[C@@H]2C1 |
| InChI | InChI=1S/C19H19FN2O3S/c20-14-5-7-15(8-6-14)21-17-4-2-1-3-16(17)19(23)22-11-13-9-10-26(24,25)18(13)12-22/h1-8,13,18,21H,9-12H2/t13-,18+/m0/s1 |
| InChIKey | HORLIOBLYDSVLD-SCLBCKFNSA-N |
| XLogP | 2.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |