C14H16N2O4S — CID 176801932
[(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(3-phenyloxaziridin-2-yl)methanone (PubChem CID 176801932) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(3-phenyloxaziridin-2-yl)methanone.
| Compound Name | [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(3-phenyloxaziridin-2-yl)methanone |
|---|---|
| PubChem CID | 176801932 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [(3aS,6aS)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(3-phenyloxaziridin-2-yl)methanone |
| SMILES | O=C(N1C[C@@H]2CCS(=O)(=O)[C@@H]2C1)N1OC1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O4S/c17-14(16-13(20-16)10-4-2-1-3-5-10)15-8-11-6-7-21(18,19)12(11)9-15/h1-5,11-13H,6-9H2/t11-,12+,13?,16?/m0/s1 |
| InChIKey | NLTVXIIVIQLPNW-BEBLISSESA-N |
| XLogP | 1.17 |
| TPSA | 69.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|