C15H17N3O3S — CID 162631030
(3aS,6aS)-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide (PubChem CID 162631030) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is (3aS,6aS)-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide.
| Compound Name | (3aS,6aS)-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
|---|---|
| PubChem CID | 162631030 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (3aS,6aS)-5-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@H]2CN(Cc3noc(-c4ccccc4)n3)C[C@H]21 |
| InChI | InChI=1S/C15H17N3O3S/c19-22(20)7-6-12-8-18(9-13(12)22)10-14-16-15(21-17-14)11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13+/m0/s1 |
| InChIKey | IVJSDCSFCQUJCB-QWHCGFSZSA-N |
| XLogP | 1.36 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |