C38H47N9O6 — CID 163600008
(4-azidopiperidin-1-yl)-(3-phenyloxaziridin-2-yl)methanone;N,N-diethyl-3-phenyloxaziridine-2-carboxamide;(3-phenyloxaziridin-2-yl)-piperidin-1-ylmethanone (PubChem CID 163600008) has the molecular formula C38H47N9O6 and a molecular weight of 725.85 g/mol. Its IUPAC name is (4-azidopiperidin-1-yl)-(3-phenyloxaziridin-2-yl)methanone;N,N-diethyl-3-phenyloxaziridine-2-carboxamide;(3-phenyloxaziridin-2-yl)-piperidin-1-ylmethanone.
| Compound Name | (4-azidopiperidin-1-yl)-(3-phenyloxaziridin-2-yl)methanone;N,N-diethyl-3-phenyloxaziridine-2-carboxamide;(3-phenyloxaziridin-2-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 163600008 |
| Molecular Formula | C38H47N9O6 |
| Molecular Weight | 725.85 g/mol |
| Exact Mass | 725.36 |
| IUPAC Name | (4-azidopiperidin-1-yl)-(3-phenyloxaziridin-2-yl)methanone;N,N-diethyl-3-phenyloxaziridine-2-carboxamide;(3-phenyloxaziridin-2-yl)-piperidin-1-ylmethanone |
| SMILES | CCN(CC)C(=O)N1OC1c1ccccc1.O=C(N1CCCCC1)N1OC1c1ccccc1.[N-]=[N+]=NC1CCN(C(=O)N2OC2c2ccccc2)CC1 |
| InChI | InChI=1S/C13H15N5O2.C13H16N2O2.C12H16N2O2/c14-16-15-11-6-8-17(9-7-11)13(19)18-12(20-18)10-4-2-1-3-5-10;16-13(14-9-5-2-6-10-14)15-12(17-15)11-7-3-1-4-8-11;1-3-13(4-2)12(15)14-11(16-14)10-8-6-5-7-9-10/h1-5,11-12H,6-9H2;1,3-4,7-8,12H,2,5-6,9-10H2;5-9,11H,3-4H2,1-2H3 |
| InChIKey | GWUDRTWIUDKEIX-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 156.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.85 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|