C26H32N2O2 — CID 146394219
N,N-dicyclohexyl-3-(4-phenylphenyl)oxaziridine-2-carboxamide (PubChem CID 146394219) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N,N-dicyclohexyl-3-(4-phenylphenyl)oxaziridine-2-carboxamide.
| Compound Name | N,N-dicyclohexyl-3-(4-phenylphenyl)oxaziridine-2-carboxamide |
|---|---|
| PubChem CID | 146394219 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N,N-dicyclohexyl-3-(4-phenylphenyl)oxaziridine-2-carboxamide |
| SMILES | O=C(N1OC1c1ccc(-c2ccccc2)cc1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H32N2O2/c29-26(27(23-12-6-2-7-13-23)24-14-8-3-9-15-24)28-25(30-28)22-18-16-21(17-19-22)20-10-4-1-5-11-20/h1,4-5,10-11,16-19,23-25H,2-3,6-9,12-15H2 |
| InChIKey | JITZYUQYJGFLAB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 35.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|