About N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide
N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide (PubChem CID 66681847) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide |
| PubChem CID | 66681847 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide |
| SMILES | CN(C(=O)n1cnc(-c2ccccc2)n1)C1CCCCC1 |
| InChI | InChI=1S/C16H20N4O/c1-19(14-10-6-3-7-11-14)16(21)20-12-17-15(18-20)13-8-4-2-5-9-13/h2,4-5,8-9,12,14H,3,6-7,10-11H2,1H3 |
| InChIKey | TUXLUMMUOWPRPT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide?
The IUPAC name of N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide (CID 66681847) is N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide?
The canonical SMILES for N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide is CN(C(=O)n1cnc(-c2ccccc2)n1)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide?
The InChIKey is TUXLUMMUOWPRPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-19(14-10-6-3-7-11-14)16(21)20-12-17-15(18-20)13-8-4-2-5-9-13/h2,4-5,8-9,12,14H,3,6-7,10-11H2,1H3.
What are the key properties of N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide?
N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide has a molecular weight of 284.36 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-methyl-3-phenyl-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 66681847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).