C15H20N4O — CID 121338273
N-methyl-N-pentyl-3-phenyl-1,2,4-triazole-1-carboxamide (PubChem CID 121338273) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-methyl-N-pentyl-3-phenyl-1,2,4-triazole-1-carboxamide.
| Compound Name | N-methyl-N-pentyl-3-phenyl-1,2,4-triazole-1-carboxamide |
|---|---|
| PubChem CID | 121338273 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-methyl-N-pentyl-3-phenyl-1,2,4-triazole-1-carboxamide |
| SMILES | CCCCCN(C)C(=O)n1cnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H20N4O/c1-3-4-8-11-18(2)15(20)19-12-16-14(17-19)13-9-6-5-7-10-13/h5-7,9-10,12H,3-4,8,11H2,1-2H3 |
| InChIKey | LGYGMHGCYRDHTH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|