C12H15ClN2O3S2 — CID 136588124
(3aS,6aS)-N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole-5-carboxamide (PubChem CID 136588124) has the molecular formula C12H15ClN2O3S2 and a molecular weight of 334.85 g/mol. Its IUPAC name is (3aS,6aS)-N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aS)-N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136588124 |
| Molecular Formula | C12H15ClN2O3S2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (3aS,6aS)-N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)s1)N1C[C@@H]2CCS(=O)(=O)[C@@H]2C1 |
| InChI | InChI=1S/C12H15ClN2O3S2/c13-11-2-1-9(19-11)5-14-12(16)15-6-8-3-4-20(17,18)10(8)7-15/h1-2,8,10H,3-7H2,(H,14,16)/t8-,10+/m0/s1 |
| InChIKey | XBCLPUSQISNHGA-WCBMZHEXSA-N |
| XLogP | 1.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |