C14H17ClN6O2S — CID 126826858
4-(4-carbamoyltriazol-1-yl)-N-[(5-chlorothiophen-2-yl)methyl]piperidine-1-carboxamide (PubChem CID 126826858) has the molecular formula C14H17ClN6O2S and a molecular weight of 368.85 g/mol. Its IUPAC name is 4-(4-carbamoyltriazol-1-yl)-N-[(5-chlorothiophen-2-yl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-(4-carbamoyltriazol-1-yl)-N-[(5-chlorothiophen-2-yl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126826858 |
| Molecular Formula | C14H17ClN6O2S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 4-(4-carbamoyltriazol-1-yl)-N-[(5-chlorothiophen-2-yl)methyl]piperidine-1-carboxamide |
| SMILES | NC(=O)c1cn(C2CCN(C(=O)NCc3ccc(Cl)s3)CC2)nn1 |
| InChI | InChI=1S/C14H17ClN6O2S/c15-12-2-1-10(24-12)7-17-14(23)20-5-3-9(4-6-20)21-8-11(13(16)22)18-19-21/h1-2,8-9H,3-7H2,(H2,16,22)(H,17,23) |
| InChIKey | YLASQSJLBKZTFG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |