C15H21ClN2O2S — CID 124611075
(4aR,8aR)-N-[(5-chlorothiophen-2-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide (PubChem CID 124611075) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.87 g/mol. Its IUPAC name is (4aR,8aR)-N-[(5-chlorothiophen-2-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide.
| Compound Name | (4aR,8aR)-N-[(5-chlorothiophen-2-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 124611075 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (4aR,8aR)-N-[(5-chlorothiophen-2-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)s1)N1CC[C@]2(O)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C15H21ClN2O2S/c16-13-5-4-12(21-13)9-17-14(19)18-8-7-15(20)6-2-1-3-11(15)10-18/h4-5,11,20H,1-3,6-10H2,(H,17,19)/t11-,15-/m1/s1 |
| InChIKey | DLJCHDNHWKRGEA-IAQYHMDHSA-N |
| XLogP | 3.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |