C17H28N4O3 — CID 99696233
(4aR,8aS)-N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide (PubChem CID 99696233) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is (4aR,8aS)-N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide.
| Compound Name | (4aR,8aS)-N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 99696233 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (4aR,8aS)-N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
| SMILES | CC(C)(C)c1nc(CNC(=O)N2CC[C@]3(O)CCCC[C@H]3C2)no1 |
| InChI | InChI=1S/C17H28N4O3/c1-16(2,3)14-19-13(20-24-14)10-18-15(22)21-9-8-17(23)7-5-4-6-12(17)11-21/h12,23H,4-11H2,1-3H3,(H,18,22)/t12-,17+/m0/s1 |
| InChIKey | HCQAYZRCVQLZMT-YVEFUNNKSA-N |
| XLogP | 2.20 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |