C22H32N2O4 — CID 71829762
tert-butyl N-[[4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]phenyl]methyl]carbamate (PubChem CID 71829762) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl N-[[4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 71829762 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | tert-butyl N-[[4-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)N2CC[C@@]3(O)CCCC[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H32N2O4/c1-21(2,3)28-20(26)23-14-16-7-9-17(10-8-16)19(25)24-13-12-22(27)11-5-4-6-18(22)15-24/h7-10,18,27H,4-6,11-15H2,1-3H3,(H,23,26)/t18-,22-/m0/s1 |
| InChIKey | NHGLWBFIFOMVLG-AVRDEDQJSA-N |
| XLogP | 3.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |