C24H29N3O4 — CID 140891865
tert-butyl N-[(1,4-dibenzoylpiperazin-2-yl)methyl]carbamate (PubChem CID 140891865) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl N-[(1,4-dibenzoylpiperazin-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(1,4-dibenzoylpiperazin-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 140891865 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl N-[(1,4-dibenzoylpiperazin-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CN(C(=O)c2ccccc2)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O4/c1-24(2,3)31-23(30)25-16-20-17-26(21(28)18-10-6-4-7-11-18)14-15-27(20)22(29)19-12-8-5-9-13-19/h4-13,20H,14-17H2,1-3H3,(H,25,30) |
| InChIKey | SUSBRYZCJLVHJN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |