C23H35N3O4 — CID 56539223
tert-butyl N-[[1-[3-(morpholin-4-ylmethyl)benzoyl]piperidin-2-yl]methyl]carbamate (PubChem CID 56539223) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl N-[[1-[3-(morpholin-4-ylmethyl)benzoyl]piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[3-(morpholin-4-ylmethyl)benzoyl]piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 56539223 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | tert-butyl N-[[1-[3-(morpholin-4-ylmethyl)benzoyl]piperidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCN1C(=O)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C23H35N3O4/c1-23(2,3)30-22(28)24-16-20-9-4-5-10-26(20)21(27)19-8-6-7-18(15-19)17-25-11-13-29-14-12-25/h6-8,15,20H,4-5,9-14,16-17H2,1-3H3,(H,24,28) |
| InChIKey | PSJRQCVVCIQHGM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |