C19H28N4O2 — CID 124879669
(4aS,8aR)-N-[2-(2-cyclopropylpyrimidin-5-yl)ethyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide (PubChem CID 124879669) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (4aS,8aR)-N-[2-(2-cyclopropylpyrimidin-5-yl)ethyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide.
| Compound Name | (4aS,8aR)-N-[2-(2-cyclopropylpyrimidin-5-yl)ethyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 124879669 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (4aS,8aR)-N-[2-(2-cyclopropylpyrimidin-5-yl)ethyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
| SMILES | O=C(NCCc1cnc(C2CC2)nc1)N1CC[C@@]2(O)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C19H28N4O2/c24-18(23-10-8-19(25)7-2-1-3-16(19)13-23)20-9-6-14-11-21-17(22-12-14)15-4-5-15/h11-12,15-16,25H,1-10,13H2,(H,20,24)/t16-,19+/m1/s1 |
| InChIKey | NDIPBDMPIODZPZ-APWZRJJASA-N |
| XLogP | 2.23 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |