C21H25FN4O3S — CID 30890047
[2-(4-fluoroanilino)phenyl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 30890047) has the molecular formula C21H25FN4O3S and a molecular weight of 432.52 g/mol. Its IUPAC name is [2-(4-fluoroanilino)phenyl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [2-(4-fluoroanilino)phenyl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 30890047 |
| Molecular Formula | C21H25FN4O3S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [2-(4-fluoroanilino)phenyl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccccc1Nc1ccc(F)cc1)N1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C21H25FN4O3S/c22-17-7-9-18(10-8-17)23-20-6-2-1-5-19(20)21(27)24-13-15-26(16-14-24)30(28,29)25-11-3-4-12-25/h1-2,5-10,23H,3-4,11-16H2 |
| InChIKey | VTHHCVFTKLCKQA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |