C17H22N4O2S — CID 136588374
N-[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methyl-4,5,6,7-tetrahydroindazole-3-sulfonamide (PubChem CID 136588374) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methyl-4,5,6,7-tetrahydroindazole-3-sulfonamide.
| Compound Name | N-[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methyl-4,5,6,7-tetrahydroindazole-3-sulfonamide |
|---|---|
| PubChem CID | 136588374 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methyl-4,5,6,7-tetrahydroindazole-3-sulfonamide |
| SMILES | Cn1nc2c(c1S(=O)(=O)N[C@@H]1Cc3ccccc3[C@H]1N)CCCC2 |
| InChI | InChI=1S/C17H22N4O2S/c1-21-17(13-8-4-5-9-14(13)19-21)24(22,23)20-15-10-11-6-2-3-7-12(11)16(15)18/h2-3,6-7,15-16,20H,4-5,8-10,18H2,1H3/t15-,16-/m1/s1 |
| InChIKey | SVGAGUZOUYZCLI-HZPDHXFCSA-N |
| XLogP | 1.20 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |