C10H15NO2 — CID 136588922
N-[(2S,3R)-2-cyclopropyloxolan-3-yl]prop-2-enamide (PubChem CID 136588922) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[(2S,3R)-2-cyclopropyloxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(2S,3R)-2-cyclopropyloxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 136588922 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[(2S,3R)-2-cyclopropyloxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCO[C@H]1C1CC1 |
| InChI | InChI=1S/C10H15NO2/c1-2-9(12)11-8-5-6-13-10(8)7-3-4-7/h2,7-8,10H,1,3-6H2,(H,11,12)/t8-,10+/m1/s1 |
| InChIKey | CCBJXGXWELNXGV-SCZZXKLOSA-N |
| XLogP | 0.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|