C10H17NO3 — CID 103864240
N-(2-cyclopropyloxolan-3-yl)-2-methoxyacetamide (PubChem CID 103864240) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(2-cyclopropyloxolan-3-yl)-2-methoxyacetamide.
| Compound Name | N-(2-cyclopropyloxolan-3-yl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 103864240 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N-(2-cyclopropyloxolan-3-yl)-2-methoxyacetamide |
| SMILES | COCC(=O)NC1CCOC1C1CC1 |
| InChI | InChI=1S/C10H17NO3/c1-13-6-9(12)11-8-4-5-14-10(8)7-2-3-7/h7-8,10H,2-6H2,1H3,(H,11,12) |
| InChIKey | ARLVCKBKJAWZEZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |