C16H26N2O4 — CID 97379853
N-[(4aS,8R,8aS)-6-(2-methoxyacetyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide (PubChem CID 97379853) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-(2-methoxyacetyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide.
| Compound Name | N-[(4aS,8R,8aS)-6-(2-methoxyacetyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide |
|---|---|
| PubChem CID | 97379853 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-(2-methoxyacetyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide |
| SMILES | COCC(=O)N1C[C@@H]2CCCO[C@@H]2[C@H](NC(=O)CC2CC2)C1 |
| InChI | InChI=1S/C16H26N2O4/c1-21-10-15(20)18-8-12-3-2-6-22-16(12)13(9-18)17-14(19)7-11-4-5-11/h11-13,16H,2-10H2,1H3,(H,17,19)/t12-,13+,16-/m0/s1 |
| InChIKey | WYJBZDLYJBXLHX-ZENOOKHLSA-N |
| XLogP | 0.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |