C11H20N2O2 — CID 61277574
1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone (PubChem CID 61277574) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone.
| Compound Name | 1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 61277574 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1C[C@H]2CCC(N)C[C@H]2C1 |
| InChI | InChI=1S/C11H20N2O2/c1-15-7-11(14)13-5-8-2-3-10(12)4-9(8)6-13/h8-10H,2-7,12H2,1H3/t8-,9+,10?/m1/s1 |
| InChIKey | MAQJHQPRQCVAOH-ZDGBYWQASA-N |
| XLogP | 0.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |