C18H34N2O — CID 65428472
1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]decan-1-one (PubChem CID 65428472) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]decan-1-one.
| Compound Name | 1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]decan-1-one |
|---|---|
| PubChem CID | 65428472 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 1-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1C[C@H]2CCC(N)C[C@H]2C1 |
| InChI | InChI=1S/C18H34N2O/c1-2-3-4-5-6-7-8-9-18(21)20-13-15-10-11-17(19)12-16(15)14-20/h15-17H,2-14,19H2,1H3/t15-,16+,17?/m1/s1 |
| InChIKey | OMPHNVSCTCGLBQ-GARXDOFDSA-N |
| XLogP | 3.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|