C21H33F3N2O5 — CID 155849020
N-[(4aS,8R,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155849020) has the molecular formula C21H33F3N2O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(4aS,8R,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849020 |
| Molecular Formula | C21H33F3N2O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-(oxan-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-cyclopropylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC1CC1)N[C@@H]1CN(CC2CCOCC2)C[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H32N2O3.C2HF3O2/c22-18(10-14-3-4-14)20-17-13-21(11-15-5-8-23-9-6-15)12-16-2-1-7-24-19(16)17;3-2(4,5)1(6)7/h14-17,19H,1-13H2,(H,20,22);(H,6,7)/t16-,17+,19-;/m0./s1 |
| InChIKey | BPIURFPFNMCIAW-VENMBWNLSA-N |
| XLogP | 2.44 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |