C15H23F3N2O3 — CID 167780963
N-[1-acetyl-6-(trifluoromethyl)piperidin-3-yl]-2-(oxan-4-yl)acetamide (PubChem CID 167780963) has the molecular formula C15H23F3N2O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[1-acetyl-6-(trifluoromethyl)piperidin-3-yl]-2-(oxan-4-yl)acetamide.
| Compound Name | N-[1-acetyl-6-(trifluoromethyl)piperidin-3-yl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 167780963 |
| Molecular Formula | C15H23F3N2O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[1-acetyl-6-(trifluoromethyl)piperidin-3-yl]-2-(oxan-4-yl)acetamide |
| SMILES | CC(=O)N1CC(NC(=O)CC2CCOCC2)CCC1C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O3/c1-10(21)20-9-12(2-3-13(20)15(16,17)18)19-14(22)8-11-4-6-23-7-5-11/h11-13H,2-9H2,1H3,(H,19,22) |
| InChIKey | RDKSQXUCORWACX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |