C12H22FN3O — CID 136588958
(7S,8aS)-N-butyl-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 136588958) has the molecular formula C12H22FN3O and a molecular weight of 243.33 g/mol. Its IUPAC name is (7S,8aS)-N-butyl-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7S,8aS)-N-butyl-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 136588958 |
| Molecular Formula | C12H22FN3O |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (7S,8aS)-N-butyl-7-fluoro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CCCCNC(=O)N1CCN2C[C@@H](F)C[C@H]2C1 |
| InChI | InChI=1S/C12H22FN3O/c1-2-3-4-14-12(17)16-6-5-15-8-10(13)7-11(15)9-16/h10-11H,2-9H2,1H3,(H,14,17)/t10-,11-/m0/s1 |
| InChIKey | SAVGLWFVFJRANF-QWRGUYRKSA-N |
| XLogP | 1.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|