C18H23F3N4O4 — CID 136590488
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-1,2-oxazol-4-yl]methanone (PubChem CID 136590488) has the molecular formula C18H23F3N4O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-1,2-oxazol-4-yl]methanone.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-1,2-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 136590488 |
| Molecular Formula | C18H23F3N4O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[3-[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]-5-methyl-1,2-oxazol-4-yl]methanone |
| SMILES | Cc1nn(C)c(OCC(F)(F)F)c1-c1noc(C)c1C(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C18H23F3N4O4/c1-9-6-25(7-10(2)28-9)16(26)14-12(4)29-23-15(14)13-11(3)22-24(5)17(13)27-8-18(19,20)21/h9-10H,6-8H2,1-5H3/t9-,10+ |
| InChIKey | ACEINIREDLQNDA-AOOOYVTPSA-N |
| XLogP | 2.88 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |