C15H22ClN5 — CID 136591052
6-[2-(3-chlorophenyl)ethylimino]-2-methyl-N-propan-2-yl-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136591052) has the molecular formula C15H22ClN5 and a molecular weight of 307.83 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)ethylimino]-2-methyl-N-propan-2-yl-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-[2-(3-chlorophenyl)ethylimino]-2-methyl-N-propan-2-yl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136591052 |
| Molecular Formula | C15H22ClN5 |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 6-[2-(3-chlorophenyl)ethylimino]-2-methyl-N-propan-2-yl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CC(C)NC1=NC(C)N/C(=N\CCc2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C15H22ClN5/c1-10(2)18-15-20-11(3)19-14(21-15)17-8-7-12-5-4-6-13(16)9-12/h4-6,9-11H,7-8H2,1-3H3,(H3,17,18,19,20,21) |
| InChIKey | WZPIREGYGPLCGS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|