C9H12 — CID 136594960
5-ethylidene-2-methylcyclohexa-1,3-diene (PubChem CID 136594960) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is 5-ethylidene-2-methylcyclohexa-1,3-diene.
| Compound Name | 5-ethylidene-2-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 136594960 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 5-ethylidene-2-methylcyclohexa-1,3-diene |
| SMILES | CC=C1C=CC(C)=CC1 |
| InChI | InChI=1S/C9H12/c1-3-9-6-4-8(2)5-7-9/h3-6H,7H2,1-2H3 |
| InChIKey | CMTVEPYVYZYBKZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |