About 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene
7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene (PubChem CID 13057529) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene.
Analyze 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene?
The IUPAC name of 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene (CID 13057529) is 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene.
What is the SMILES notation for 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene?
The canonical SMILES for 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene is CC1=CCC2=C(C=C1)CCCC2.
What is the InChIKey of 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene?
The InChIKey is PZUPYEVPXFKMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-10-6-8-11-4-2-3-5-12(11)9-7-10/h6-8H,2-5,9H2,1H3.
What are the key properties of 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene?
7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene has a molecular weight of 160.26 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3,4,9-tetrahydro-1H-benzo[7]annulene is sourced from PubChem (CID 13057529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).