About ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine
ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine (PubChem CID 177053758) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine.
Analyze ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine?
The IUPAC name of ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine (CID 177053758) is ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine.
What is the SMILES notation for ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine?
The canonical SMILES for ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine is C1=CC2=C(CCC2)CN1.CC.
What is the InChIKey of ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine?
The InChIKey is TVVDLJGMYIRLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C2H6/c1-2-7-4-5-9-6-8(7)3-1;1-2/h4-5,9H,1-3,6H2;1-2H3.
What are the key properties of ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine?
ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine has a molecular weight of 151.25 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,5,6,7-tetrahydro-1H-cyclopenta[c]pyridine is sourced from PubChem (CID 177053758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).