C14H16 — CID 142424223
5-ethyl-1,2,3,4-tetrahydro-s-indacene (PubChem CID 142424223) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-ethyl-1,2,3,4-tetrahydro-s-indacene.
| Compound Name | 5-ethyl-1,2,3,4-tetrahydro-s-indacene |
|---|---|
| PubChem CID | 142424223 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 5-ethyl-1,2,3,4-tetrahydro-s-indacene |
| SMILES | CCC1=C2CC3=C(C=C2C=C1)CCC3 |
| InChI | InChI=1S/C14H16/c1-2-10-6-7-13-8-11-4-3-5-12(11)9-14(10)13/h6-8H,2-5,9H2,1H3 |
| InChIKey | DZOBSCWTFIXJBT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |