About 6-methylbicyclo[3.2.0]hepta-1(5),6-diene
6-methylbicyclo[3.2.0]hepta-1(5),6-diene (PubChem CID 91189897) has the molecular formula C8H10
and a molecular weight of 106.17 g/mol. Its IUPAC name is 6-methylbicyclo[3.2.0]hepta-1(5),6-diene.
Analyze 6-methylbicyclo[3.2.0]hepta-1(5),6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylbicyclo[3.2.0]hepta-1(5),6-diene?
The IUPAC name of 6-methylbicyclo[3.2.0]hepta-1(5),6-diene (CID 91189897) is 6-methylbicyclo[3.2.0]hepta-1(5),6-diene.
What is the SMILES notation for 6-methylbicyclo[3.2.0]hepta-1(5),6-diene?
The canonical SMILES for 6-methylbicyclo[3.2.0]hepta-1(5),6-diene is CC1=CC2=C1CCC2.
What is the InChIKey of 6-methylbicyclo[3.2.0]hepta-1(5),6-diene?
The InChIKey is FSNNNEDKYQDHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10/c1-6-5-7-3-2-4-8(6)7/h5H,2-4H2,1H3.
What are the key properties of 6-methylbicyclo[3.2.0]hepta-1(5),6-diene?
6-methylbicyclo[3.2.0]hepta-1(5),6-diene has a molecular weight of 106.17 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylbicyclo[3.2.0]hepta-1(5),6-diene is sourced from PubChem (CID 91189897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).