C8H8 — CID 91029970
2,3-dihydro-1H-pentalene (PubChem CID 91029970) has the molecular formula C8H8 and a molecular weight of 104.15 g/mol. Its IUPAC name is 2,3-dihydro-1H-pentalene.
| Compound Name | 2,3-dihydro-1H-pentalene |
|---|---|
| PubChem CID | 91029970 |
| Molecular Formula | C8H8 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | 2,3-dihydro-1H-pentalene |
| SMILES | C1=CC2=C(C=1)CCC2 |
| InChI | InChI=1S/C8H8/c1-3-7-5-2-6-8(7)4-1/h5-6H,1,3-4H2 |
| InChIKey | IPLRMSGVLLZLBA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |