C11H14S — CID 143195799
2,3-dihydrocyclohepta[b]thiophene;ethane (PubChem CID 143195799) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is 2,3-dihydrocyclohepta[b]thiophene;ethane.
| Compound Name | 2,3-dihydrocyclohepta[b]thiophene;ethane |
|---|---|
| PubChem CID | 143195799 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2,3-dihydrocyclohepta[b]thiophene;ethane |
| SMILES | C1=CC=CC2=C(C=1)CCS2.CC |
| InChI | InChI=1S/C9H8S.C2H6/c1-2-4-8-6-7-10-9(8)5-3-1;1-2/h1,3-5H,6-7H2;1-2H3 |
| InChIKey | AMXMCLOLTYFHNP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |