C21H16 — CID 90876142
tetracyclo[13.6.0.02,7.08,14]henicosa-1(15),2,4,6,8(14),9,11,12,18,19-decaene (PubChem CID 90876142) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is tetracyclo[13.6.0.02,7.08,14]henicosa-1(15),2,4,6,8(14),9,11,12,18,19-decaene.
| Compound Name | tetracyclo[13.6.0.02,7.08,14]henicosa-1(15),2,4,6,8(14),9,11,12,18,19-decaene |
|---|---|
| PubChem CID | 90876142 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | tetracyclo[13.6.0.02,7.08,14]henicosa-1(15),2,4,6,8(14),9,11,12,18,19-decaene |
| SMILES | C1=CCCc2c3c(c4ccccc4c2CC=1)C=CC=C=C3 |
| InChI | InChI=1S/C21H16/c1-2-5-11-17-16(10-4-1)18-12-6-3-7-13-19(18)21-15-9-8-14-20(17)21/h1,3,5,7-9,12-15H,4,10-11H2 |
| InChIKey | QDRPXUOGUDXJDK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |