About cyclohepta[a]naphthalene
cyclohepta[a]naphthalene (PubChem CID 143335474) has the molecular formula C15H10
and a molecular weight of 190.24 g/mol. Its IUPAC name is cyclohepta[a]naphthalene.
Molecular Properties
| Compound Name | cyclohepta[a]naphthalene |
| PubChem CID | 143335474 |
| Molecular Formula | C15H10 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | cyclohepta[a]naphthalene |
| SMILES | C1=CC=Cc2c(ccc3ccccc23)C=1 |
| InChI | InChI=1S/C15H10/c1-2-6-12-10-11-13-7-4-5-9-15(13)14(12)8-3-1/h1,3-11H |
| InChIKey | QGMLMIHCLRSGDF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclohepta[a]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[a]naphthalene?
The IUPAC name of cyclohepta[a]naphthalene (CID 143335474) is cyclohepta[a]naphthalene.
What is the SMILES notation for cyclohepta[a]naphthalene?
The canonical SMILES for cyclohepta[a]naphthalene is C1=CC=Cc2c(ccc3ccccc23)C=1.
What is the InChIKey of cyclohepta[a]naphthalene?
The InChIKey is QGMLMIHCLRSGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10/c1-2-6-12-10-11-13-7-4-5-9-15(13)14(12)8-3-1/h1,3-11H.
What are the key properties of cyclohepta[a]naphthalene?
cyclohepta[a]naphthalene has a molecular weight of 190.24 g/mol, XLogP of 4.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[a]naphthalene is sourced from PubChem (CID 143335474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).