About 3H-benzo[e]indol-3-ium iodide
3H-benzo[e]indol-3-ium iodide (PubChem CID 22715271) has the molecular formula C12H10IN
and a molecular weight of 295.12 g/mol. Its IUPAC name is 3H-benzo[e]indol-3-ium iodide.
Molecular Properties
| Compound Name | 3H-benzo[e]indol-3-ium iodide |
| PubChem CID | 22715271 |
| Molecular Formula | C12H10IN |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 3H-benzo[e]indol-3-ium iodide |
| SMILES | C1=Cc2c(ccc3ccccc23)[NH2+]1.[I-] |
| InChI | InChI=1S/C12H9N.HI/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;/h1-8,13H;1H |
| InChIKey | XULYUQFXXGHABY-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3H-benzo[e]indol-3-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-benzo[e]indol-3-ium iodide?
The IUPAC name of 3H-benzo[e]indol-3-ium iodide (CID 22715271) is 3H-benzo[e]indol-3-ium iodide.
What is the SMILES notation for 3H-benzo[e]indol-3-ium iodide?
The canonical SMILES for 3H-benzo[e]indol-3-ium iodide is C1=Cc2c(ccc3ccccc23)[NH2+]1.[I-].
What is the InChIKey of 3H-benzo[e]indol-3-ium iodide?
The InChIKey is XULYUQFXXGHABY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.HI/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;/h1-8,13H;1H.
What are the key properties of 3H-benzo[e]indol-3-ium iodide?
3H-benzo[e]indol-3-ium iodide has a molecular weight of 295.12 g/mol, XLogP of -0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-benzo[e]indol-3-ium iodide is sourced from PubChem (CID 22715271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).